|
CAS#: 864754-32-5 Product: 1,2-Dimethyl-1H-Indole-7-Boronic Acid No suppilers available for the product. |
| Name | 1,2-Dimethyl-1H-Indole-7-Boronic Acid |
|---|---|
| Synonyms | Fs000784 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12BNO2 |
| Molecular Weight | 189.02 |
| CAS Registry Number | 864754-32-5 |
| SMILES | C1=C([N](C2=C1C=CC=C2B(O)O)C)C |
| InChI | 1S/C10H12BNO2/c1-7-6-8-4-3-5-9(11(13)14)10(8)12(7)2/h3-6,13-14H,1-2H3 |
| InChIKey | ZKBDZVUNYSRPFU-UHFFFAOYSA-N |
| Density | 1.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.225°C at 760 mmHg (Cal.) |
| Flash point | 203.107°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dimethyl-1H-Indole-7-Boronic Acid |