Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Methoserpidine |
|---|---|
| Synonyms | Methoserpidine [Ban:Dcf:Inn]; Methoserpidinum [Inn-Latin]; Metoserpidina [Inn-Spanish] |
| Molecular Structure |  |
| Molecular Formula | C33H40N2O9 |
| Molecular Weight | 608.69 |
| CAS Registry Number | 865-04-3 |
| EINECS | 212-733-5 |
| SMILES | [C@@H]34C2=C(C1=CC(=CC=C1[NH]2)OC)CCN3C[C@@H]5[C@H](C4)[C@@H]([C@H]([C@@H](C5)OC(C6=CC(=C(C(=C6)OC)OC)OC)=O)OC)C(=O)OC |
| InChI | 1S/C33H40N2O9/c1-38-19-7-8-23-22(14-19)20-9-10-35-16-18-13-27(44-32(36)17-11-25(39-2)30(41-4)26(12-17)40-3)31(42-5)28(33(37)43-6)21(18)15-24(35)29(20)34-23/h7-8,11-12,14,18,21,24,27-28,31,34H,9-10,13,15-16H2,1-6H3/t18-,21+,24-,27-,28+,31+/m1/s1 |
| InChIKey | ULBNWNUHGJLQHO-VKMIBBQISA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 700.058°C at 760 mmHg (Cal.) |
| Flash point | 377.182°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methoserpidine |