Online Database of Chemicals from Around the World
|
CAS#: 865-76-9 Product: Decamethyltetrasilane No suppilers available for the product. |
| Name | Decamethyltetrasilane |
|---|---|
| Synonyms | (Dimethyl-Trimethylsilyl-Silyl)-Dimethyl-Trimethylsilyl-Silane; Decamethyltetrasilane; Tetrasilane, Decamethyl- |
| Molecular Structure |  |
| Molecular Formula | C10H30Si4 |
| Molecular Weight | 262.69 |
| CAS Registry Number | 865-76-9 |
| SMILES | C[Si]([Si]([Si](C)(C)C)(C)C)([Si](C)(C)C)C |
| InChI | 1S/C10H30Si4/c1-11(2,3)13(7,8)14(9,10)12(4,5)6/h1-10H3 |
| InChIKey | WYNNMDYMPQMXFH-UHFFFAOYSA-N |
| Density | 0.781g/cm3 (Cal.) |
|---|---|
| Boiling point | 219.592°C at 760 mmHg (Cal.) |
| Flash point | 61.559°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Decamethyltetrasilane |