Online Database of Chemicals from Around the World
|
CAS#: 865471-20-1 Product: 2-(4-Morpholinyl)-5-(trifluoromethyl)benzoic acid No suppilers available for the product. |
| Name | 2-(4-Morpholinyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| Synonyms | 2-Morpholino-5-(trifluoroMethyl)benzoic acid; BENZOIC ACID,2-(4-MORPHOLINYL)-5-(TRIFLUOROMETHYL)- |
| Molecular Structure |  |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.22 |
| CAS Registry Number | 865471-20-1 |
| SMILES | c1cc(c(cc1C(F)(F)F)C(=O)O)N2CCOCC2 |
| InChI | 1S/C12H12F3NO3/c13-12(14,15)8-1-2-10(9(7-8)11(17)18)16-3-5-19-6-4-16/h1-2,7H,3-6H2,(H,17,18) |
| InChIKey | PRECFTDWCNEEDB-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.729°C at 760 mmHg (Cal.) |
| Flash point | 193.13°C (Cal.) |
| Refractive index | 1.515 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(4-Morpholinyl)-5-(trifluoromethyl)benzoic acid |