Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-[1-(Triethylsilyl)vinyl]pyridine |
|---|---|
| Synonyms | 3-(1-(triethylsilyl)vinyl)pyridine |
| Molecular Structure | ![CAS#: 866364-44-5， 3-[1-(Triethylsilyl)vinyl]pyridine](/moreStructures/866364-44-5.gif) |
| Molecular Formula | C13H21NSi |
| Molecular Weight | 219.40 |
| CAS Registry Number | 866364-44-5 |
| SMILES | CC[Si](CC)(CC)C(=C)c1cccnc1 |
| InChI | 1S/C13H21NSi/c1-5-15(6-2,7-3)12(4)13-9-8-10-14-11-13/h8-11H,4-7H2,1-3H3 |
| InChIKey | LEJJKUZVQGEXKN-UHFFFAOYSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.481°C at 760 mmHg (Cal.) |
| Flash point | 125.245°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[1-(Triethylsilyl)vinyl]pyridine |