Online Database of Chemicals from Around the World
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (386) 462-0788 | |||
 |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 1-Ethynyl-4-(trifluoromethoxy)benzene |
|---|---|
| Synonyms | (4-ethynylphenoxy)trifluoromethane; 1-ethynyl-4-(trifluoromethoxy)-benzene; 1-Ethynyl |
| Molecular Structure |  |
| Molecular Formula | C9H5F3O |
| Molecular Weight | 186.13 |
| CAS Registry Number | 866683-57-0 |
| SMILES | C#CC1=CC=C(C=C1)OC(F)(F)F |
| InChI | 1S/C9H5F3O/c1-2-7-3-5-8(6-4-7)13-9(10,11)12/h1,3-6H |
| InChIKey | RWWGGRCLMVYXPM-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| 1.215 (Expl.) | |
| Boiling point | 158.1±40.0°C at 760 mmHg (Cal.) |
| Flash point | 55.5±23.2°C (Cal.) |
| 40°C (Expl.) | |
| Refractive index | 1.467 (Cal.) |
| 1.4554 (Expl.) | |
| Safety Description | IRRITANT |
|---|---|
| Flammable/Harmful/Irritant/Light Sensitive/Keep Cold/Store under Argon | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-Ethynyl-4-(trifluoromethoxy)benzene |