|
CAS#: 86727-00-6 Product: (2Z)-5-Bromo-5-methyl-3-phenyl-2-(phenylimino)-1,3-thiazinan-4-one No suppilers available for the product. |
| Name | (2Z)-5-Bromo-5-methyl-3-phenyl-2-(phenylimino)-1,3-thiazinan-4-one |
|---|---|
| Synonyms | 5-Bromotetrahydro-5-methyl-3-thiazinone; CK 17; CK-17 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15BrN2OS |
| Molecular Weight | 375.28 |
| CAS Registry Number | 86727-00-6 |
| SMILES | O=C2N(C(=N/c1ccccc1)/SCC2(Br)C)c3ccccc3 |
| InChI | 1S/C17H15BrN2OS/c1-17(18)12-22-16(19-13-8-4-2-5-9-13)20(15(17)21)14-10-6-3-7-11-14/h2-11H,12H2,1H3/b19-16- |
| InChIKey | ASZBPWIGUHLPML-MNDPQUGUSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.011°C at 760 mmHg (Cal.) |
| Flash point | 238.055°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)-5-Bromo-5-methyl-3-phenyl-2-(phenylimino)-1,3-thiazinan-4-one |