| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | N-[4-(2-Bromo-4,5-difluorophenoxy)phenyl]-L-asparagine |
|---|---|
| Synonyms | N-[4-(2-Bromo-4,5-difluorophenoxy)phenyl]-L-asparagine; WAY 213613; WAY-213613 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13BrF2N2O4 |
| Molecular Weight | 415.19 |
| CAS Registry Number | 868359-05-1 |
| SMILES | C1=CC(=CC=C1NC(=O)C[C@@H](C(=O)O)N)OC2=CC(=C(C=C2Br)F)F |
| InChI | 1S/C16H13BrF2N2O4/c17-10-5-11(18)12(19)6-14(10)25-9-3-1-8(2-4-9)21-15(22)7-13(20)16(23)24/h1-6,13H,7,20H2,(H,21,22)(H,23,24)/t13-/m0/s1 |
| InChIKey | BNYDDAAZMBUFRG-ZDUSSCGKSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.6±50.0°C at 760 mmHg (Cal.) |
| Flash point | 295.9±30.1°C (Cal.) |
| Refractive index | 1.632 (Cal.) |
| solubility | Soluble to 100 mM in 1eq. NaOH and to 100 mM in DMSO |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-[4-(2-Bromo-4,5-difluorophenoxy)phenyl]-L-asparagine |