Online Database of Chemicals from Around the World
|
CAS#: 86866-13-9 Product: 3,5-Dichlorobenzoic anhydride No suppilers available for the product. |
| Name | 3,5-Dichlorobenzoic anhydride |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H6Cl4O3 |
| Molecular Weight | 364.01 |
| CAS Registry Number | 86866-13-9 |
| SMILES | c1c(cc(cc1Cl)Cl)C(=O)OC(=O)c2cc(cc(c2)Cl)Cl |
| InChI | 1S/C14H6Cl4O3/c15-9-1-7(2-10(16)5-9)13(19)21-14(20)8-3-11(17)6-12(18)4-8/h1-6H |
| InChIKey | ROEKRDGVDVCTMS-UHFFFAOYSA-N |
| Density | 1.552g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.982°C at 760 mmHg (Cal.) |
| Flash point | 202.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichlorobenzoic anhydride |