Online Database of Chemicals from Around the World
|
CAS#: 86902-94-5 Product: 1,5-Diamidinobiuret No suppilers available for the product. |
| Name | 1,5-Diamidinobiuret |
|---|---|
| Synonyms | 1,5-diamidinobiuret |
| Molecular Structure |  |
| Molecular Formula | C4H9N7O2 |
| Molecular Weight | 187.16 |
| CAS Registry Number | 86902-94-5 |
| EINECS | 289-286-8 |
| SMILES | O=C(\N=C(/N)N)NC(=O)/N=C(\N)N |
| InChI | 1S/C4H9N7O2/c5-1(6)9-3(12)11-4(13)10-2(7)8/h(H9,5,6,7,8,9,10,11,12,13) |
| InChIKey | VDBAMTUNZNBVLQ-UHFFFAOYSA-N |
| Density | 2.017g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,5-Diamidinobiuret |