|
CAS#: 869802-44-8 Product: 9-(Dimethylamino)-3-(4-ethylphenyl)pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one No suppilers available for the product. |
| Name | 9-(Dimethylamino)-3-(4-ethylphenyl)pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one |
|---|---|
| Synonyms | 4-Dimethy |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.44 |
| CAS Registry Number | 869802-44-8 |
| SMILES | CCC1=CC=C(C=C1)N2C=NC3=C(C2=O)SC4=NC=CC(=C34)N(C)C |
| InChI | 1S/C19H18N4OS/c1-4-12-5-7-13(8-6-12)23-11-21-16-15-14(22(2)3)9-10-20-18(15)25-17(16)19(23)24/h5-11H,4H2,1-3H3 |
| InChIKey | VCUKKMIXURRDKL-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.8±60.0°C at 760 mmHg (Cal.) |
| Flash point | 296.6±32.9°C (Cal.) |
| Refractive index | 1.698 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(Dimethylamino)-3-(4-ethylphenyl)pyrido[3',2':4,5]thieno[3,2-d]pyrimidin-4(3H)-one |