|
CAS#: 870524-45-1 Product: 3-[4-({4-(4-Methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl}methoxy)-2-methylphenyl]propanoic acid No suppilers available for the product. |
| Name | 3-[4-({4-(4-Methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl}methoxy)-2-methylphenyl]propanoic acid |
|---|---|
| Synonyms | Benzenepr |
| Molecular Structure | ![]() |
| Molecular Formula | C28H24F3NO4S |
| Molecular Weight | 527.55 |
| CAS Registry Number | 870524-45-1 |
| SMILES | CC1=C(C=CC(=C1)OCC2=NC(=C(S2)C3=CC=C(C=C3)C(F)(F)F)C4=CC=C(C=C4)OC)CCC(=O)O |
| InChI | 1S/C28H24F3NO4S/c1-17-15-23(13-5-18(17)8-14-25(33)34)36-16-24-32-26(19-6-11-22(35-2)12-7-19)27(37-24)20-3-9-21(10-4-20)28(29,30)31/h3-7,9-13,15H,8,14,16H2,1-2H3,(H,33,34) |
| InChIKey | YNRZEUVHUMURNA-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 634.0±55.0°C at 760 mmHg (Cal.) |
| Flash point | 337.3±31.5°C (Cal.) |
| Refractive index | 1.583 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[4-({4-(4-Methoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl}methoxy)-2-methylphenyl]propanoic acid |