|
CAS#: 870610-78-9 Product: N-(2-Cyclopenten-1-yl)-4-methylbenzenesulfonamide No suppilers available for the product. |
| Name | N-(2-Cyclopenten-1-yl)-4-methylbenzenesulfonamide |
|---|---|
| Synonyms | BENZENESULFONAMIDE,N-(1S)-2-CYCLOPENTEN-1-YL-4-METHYL-; BENZENESULFONAMIDE,N-2-CYCLOPENTEN-1-YL-4-METHYL-; N-(cyclopent-2-en-1-yl)-4-methylbenzenesulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 |
| CAS Registry Number | 870610-78-9 |
| SMILES | O=S(=O)(NC1\C=C/CC1)c2ccc(cc2)C |
| InChI | 1S/C12H15NO2S/c1-10-6-8-12(9-7-10)16(14,15)13-11-4-2-3-5-11/h2,4,6-9,11,13H,3,5H2,1H3 |
| InChIKey | KFHANGVDOOPYBY-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.268°C at 760 mmHg (Cal.) |
| Flash point | 178.941°C (Cal.) |
| Refractive index | 1.594 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Cyclopenten-1-yl)-4-methylbenzenesulfonamide |