Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(1-Azepanyl)-2,2,2-trichloroethanone |
|---|---|
| Synonyms | 1-(azepan-1-yl)-2,2,2-trichloroethanone |
| Molecular Structure |  |
| Molecular Formula | C8H12Cl3NO |
| Molecular Weight | 244.55 |
| CAS Registry Number | 87081-37-6 |
| SMILES | O=C(N1CCCCCC1)C(Cl)(Cl)Cl |
| InChI | 1S/C8H12Cl3NO/c9-8(10,11)7(13)12-5-3-1-2-4-6-12/h1-6H2 |
| InChIKey | UAFISSZOAGFTMD-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.737°C at 760 mmHg (Cal.) |
| Flash point | 128.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Azepanyl)-2,2,2-trichloroethanone |