Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomole Scientific Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (27) 8262-4262 | |||
|
sales@atomole.com | |||
| Chemical manufacturer since 2008 | ||||
| Name | [3-Chloro-4-(trifluoromethoxy)phenyl]boronic acid |
|---|---|
| Synonyms | [3-Chlor-4-(trifluormethoxy)phenyl]borsäure; [3-Chloro-4-(trifluoromethoxy)phenyl]boronic acid; 3-chloro-4-(trifluoromethoxy)phenylboronic acid |
| Molecular Structure | ![CAS#: 870822-79-0， [3-Chloro-4-(trifluoromethoxy)phenyl]boronic acid](/moreStructures/870822-79-0.gif) |
| Molecular Formula | C7H5BClF3O3 |
| Molecular Weight | 240.37 |
| CAS Registry Number | 870822-79-0 |
| SMILES | B(c1ccc(c(c1)Cl)OC(F)(F)F)(O)O |
| InChI | 1S/C7H5BClF3O3/c9-5-3-4(8(13)14)1-2-6(5)15-7(10,11)12/h1-3,13-14H |
| InChIKey | LNHZFDNECMPGHG-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.3±50.0°C at 760 mmHg (Cal.) |
| Flash point | 132.4±30.1°C (Cal.) |
| Refractive index | 1.484 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for [3-Chloro-4-(trifluoromethoxy)phenyl]boronic acid |