Online Database of Chemicals from Around the World
|
CAS#: 87112-04-7 Product: (1Z)-2-(3,4-Dihydroxyphenyl)ethanimidamide No suppilers available for the product. |
| Name | (1Z)-2-(3,4-Dihydroxyphenyl)ethanimidamide |
|---|---|
| Synonyms | 3,4-dihydroxyphenylacetamidine; DHPAA |
| Molecular Structure |  |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 |
| CAS Registry Number | 87112-04-7 |
| SMILES | [H]/N=C(/Cc1ccc(c(c1)O)O)\N |
| InChI | 1S/C8H10N2O2/c9-8(10)4-5-1-2-6(11)7(12)3-5/h1-3,11-12H,4H2,(H3,9,10) |
| InChIKey | BUWZJWAQZANSHV-UHFFFAOYSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.219°C at 760 mmHg (Cal.) |
| Flash point | 188.589°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1Z)-2-(3,4-Dihydroxyphenyl)ethanimidamide |