| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Endotherm GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (681) 3946-7570 | |||
![]() |
info@endotherm.de | |||
| Chemical manufacturer | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Hydrocarbon halide |
|---|---|
| Name | 1-Chloro-2,3-dimethoxy-5-[(E)-2-nitrovinyl]benzene |
| Synonyms | 1,2-Dimethoxy-3-chloro-5-(2-nitrovinyl)benzene; 1-chloro-2,3-dimethoxy-5-[(E)-2-nitroethenyl]benzene; 2-(3-Chloro-4,5-dimethoxyphenyl)nitroethene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.64 |
| CAS Registry Number | 871126-37-3 |
| SMILES | COC1=C(C(=CC(=C1)/C=C/[N+](=O)[O-])Cl)OC |
| InChI | 1S/C10H10ClNO4/c1-15-9-6-7(3-4-12(13)14)5-8(11)10(9)16-2/h3-6H,1-2H3/b4-3+ |
| InChIKey | AYULBTLOYLJHSB-ONEGZZNKSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.7±42.0°C at 760 mmHg (Cal.) |
| Flash point | 182.9±27.9°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2,3-dimethoxy-5-[(E)-2-nitrovinyl]benzene |