| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | (2R,3S)-3-(Dibenzylamino)-2-hydroxy-4-phenylbutyl acetate |
|---|---|
| Synonyms | (3S,2R)-3-[bisbenzylamino]-2-hydroxy-4-phenylbutyl acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.51 |
| CAS Registry Number | 871948-95-7 |
| SMILES | O=C(OC[C@H](O)[C@@H](N(Cc1ccccc1)Cc2ccccc2)Cc3ccccc3)C |
| InChI | 1S/C26H29NO3/c1-21(28)30-20-26(29)25(17-22-11-5-2-6-12-22)27(18-23-13-7-3-8-14-23)19-24-15-9-4-10-16-24/h2-16,25-26,29H,17-20H2,1H3/t25-,26-/m0/s1 |
| InChIKey | CMZNZNSAXHGUBS-UIOOFZCWSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 561.632°C at 760 mmHg (Cal.) |
| Flash point | 293.465°C (Cal.) |
| Refractive index | 1.595 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3S)-3-(Dibenzylamino)-2-hydroxy-4-phenylbutyl acetate |