Online Database of Chemicals from Around the World
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (609) 434-0144 | |||
 |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1-[3-(Chloromethyl)phenyl]-2-phenylethanone |
|---|---|
| Molecular Structure | ![CAS#: 872088-04-5， 1-[3-(Chloromethyl)phenyl]-2-phenylethanone](/moreStructures/872088-04-5.gif) |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.72 |
| CAS Registry Number | 872088-04-5 |
| SMILES | ClCc1cccc(c1)C(=O)Cc2ccccc2 |
| InChI | 1S/C15H13ClO/c16-11-13-7-4-8-14(9-13)15(17)10-12-5-2-1-3-6-12/h1-9H,10-11H2 |
| InChIKey | ZMMAFWHJLFTPKD-UHFFFAOYSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.101°C at 760 mmHg (Cal.) |
| Flash point | 218.301°C (Cal.) |
| Refractive index | 1.588 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(Chloromethyl)phenyl]-2-phenylethanone |