| Glentham Life Sciences | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 4,4'-[(2-Bromo-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol |
|---|---|
| Synonyms | [872201-12-2]; 4,4'-[(2- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H17BrO2 |
| Molecular Weight | 393.27 |
| CAS Registry Number | 872201-12-2 |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=C(C=C2)/C=C/C3=CC=C(C=C3)O)Br)O |
| InChI | 1S/C22H17BrO2/c23-22-15-18(2-1-16-5-11-20(24)12-6-16)4-10-19(22)9-3-17-7-13-21(25)14-8-17/h1-15,24-25H/b2-1+,9-3+ |
| InChIKey | OXPHQQMZTXMEGO-RJTULKDBSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.0±39.0°C at 760 mmHg (Cal.) |
| Flash point | 294.3±27.1°C (Cal.) |
| Refractive index | 1.777 (Cal.) |
| solubility | Soluble to 100 mM in DMSO and to 50 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for 4,4'-[(2-Bromo-1,4-phenylene)di(E)-2,1-ethenediyl]diphenol |