|
CAS#: 87230-85-1 Product: Glycyl-L-seryl-L-histidyl-L-lysine No suppilers available for the product. |
| Name | Glycyl-L-seryl-L-histidyl-L-lysine |
|---|---|
| Synonyms | glycyl-seryl-histidyl-lysine; Gly-ser-his-lys; GSHL |
| Molecular Structure | ![]() |
| Molecular Formula | C17H29N7O6 |
| Molecular Weight | 427.46 |
| CAS Registry Number | 87230-85-1 |
| SMILES | O=C(O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CN)CO)Cc1cncn1)CCCCN |
| InChI | 1S/C17H29N7O6/c18-4-2-1-3-11(17(29)30)23-15(27)12(5-10-7-20-9-21-10)24-16(28)13(8-25)22-14(26)6-19/h7,9,11-13,25H,1-6,8,18-19H2,(H,20,21)(H,22,26)(H,23,27)(H,24,28)(H,29,30)/t11-,12-,13-/m0/s1 |
| InChIKey | WZUMSFQGYWBRNX-AVGNSLFASA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 1004.228°C at 760 mmHg (Cal.) |
| Flash point | 561.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glycyl-L-seryl-L-histidyl-L-lysine |