Online Database of Chemicals from Around the World
|
CAS#: 87260-25-1 Product: 4-Butyl-2-cyanophenyl 4-(4-propylcyclohexyl)benzoate No suppilers available for the product. |
| Name | 4-Butyl-2-cyanophenyl 4-(4-propylcyclohexyl)benzoate |
|---|---|
| Synonyms | 4-butyl-2-cyanophenyl trans-p-(4-propylcyclohexyl)benzoate |
| Molecular Structure |  |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.56 |
| CAS Registry Number | 87260-25-1 |
| EINECS | 289-310-7 |
| SMILES | CCCC1CCC(CC1)c2ccc(cc2)C(=O)Oc3ccc(CCCC)cc3C#N |
| InChI | 1S/C27H33NO2/c1-3-5-7-21-10-17-26(25(18-21)19-28)30-27(29)24-15-13-23(14-16-24)22-11-8-20(6-4-2)9-12-22/h10,13-18,20,22H,3-9,11-12H2,1-2H3 |
| InChIKey | WYTBUBSHICZERC-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.532°C at 760 mmHg (Cal.) |
| Flash point | 292.13°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Butyl-2-cyanophenyl 4-(4-propylcyclohexyl)benzoate |