Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Ethyl-1H-benzimidazole-4,7-dione |
|---|---|
| Synonyms | 2-ethyl-1H-benzo[d]imidazole-4,7-dione |
| Molecular Structure |  |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 |
| CAS Registry Number | 873205-71-1 |
| SMILES | CCc1[nH]c2c(n1)C(=O)C=CC2=O |
| InChI | 1S/C9H8N2O2/c1-2-7-10-8-5(12)3-4-6(13)9(8)11-7/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | PIAXBQCTQXLBFH-UHFFFAOYSA-N |
| Density | 1.388g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.947°C at 760 mmHg (Cal.) |
| Flash point | 235.439°C (Cal.) |
| Refractive index | 1.627 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-1H-benzimidazole-4,7-dione |