|
CAS#: 873792-94-0 Product: 4-Chloro-5-iodo-7-(beta-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine No suppilers available for the product. |
| Name | 4-Chloro-5-iodo-7-(beta-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClIN4O4 |
| Molecular Weight | 426.59 |
| CAS Registry Number | 873792-94-0 |
| SMILES | Clc3nc(nc1c3c(I)cn1[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)CO)N |
| InChI | 1S/C11H12ClIN4O4/c12-8-5-3(13)1-17(9(5)16-11(14)15-8)10-7(20)6(19)4(2-18)21-10/h1,4,6-7,10,18-20H,2H2,(H2,14,15,16)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | RYFLMNAAVNGVRF-KQYNXXCUSA-N |
| Density | 2.563g/cm3 (Cal.) |
|---|---|
| Boiling point | 751.242°C at 760 mmHg (Cal.) |
| Flash point | 408.137°C (Cal.) |
| Refractive index | 1.922 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-5-iodo-7-(beta-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |