Online Database of Chemicals from Around the World
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 2330-8079751 | |||
 |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | 1-Cyclohexylidenepropan-2-One |
|---|---|
| Synonyms | 1-Cyclohexylideneacetone; Ghl.Pd_Mitscher_Leg0.700; 2-Propanone, 1-Cyclohexylidene- |
| Molecular Structure |  |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 |
| CAS Registry Number | 874-68-0 |
| SMILES | CC([CH]=[C]1CC[CH2]CC1)=O |
| InChI | 1S/C9H14O/c1-8(10)7-9-5-3-2-4-6-9/h7H,2-6H2,1H3 |
| InChIKey | KVSOBMXTKPYCSG-UHFFFAOYSA-N |
| Density | 1.007g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.152°C at 760 mmHg (Cal.) |
| Flash point | 88.779°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Cyclohexylidenepropan-2-One |