Online Database of Chemicals from Around the World
|
CAS#: 87405-61-6 Product: 9-Amino-6-Trifluoromethylbenzonorbornene No suppilers available for the product. |
| Name | 9-Amino-6-Trifluoromethylbenzonorbornene |
|---|---|
| Synonyms | 9-Amino-6-Trifluoromethylbenzonorbornene; 9-Atfmb |
| Molecular Structure |  |
| Molecular Formula | C12H12F3N |
| Molecular Weight | 227.23 |
| CAS Registry Number | 87405-61-6 |
| SMILES | C1=C(C=CC2=C1C3CCC2C3N)C(F)(F)F |
| InChI | 1S/C12H12F3N/c13-12(14,15)6-1-2-7-8-3-4-9(11(8)16)10(7)5-6/h1-2,5,8-9,11H,3-4,16H2 |
| InChIKey | QFRCSJBYSNCGPY-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.359°C at 760 mmHg (Cal.) |
| Flash point | 114.001°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Amino-6-Trifluoromethylbenzonorbornene |