|
CAS#: 87411-30-1 Product: 4-(4-Tert-Butyl-Phenoxy)-Butyric Acid No suppilers available for the product. |
| Name | 4-(4-Tert-Butyl-Phenoxy)-Butyric Acid |
|---|---|
| Synonyms | 4-(4-Tert-Butylphenoxy)Butyrate; Zinc01777745 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19O3 |
| Molecular Weight | 235.30 |
| CAS Registry Number | 87411-30-1 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1)OCCCC([O-])=O |
| InChI | 1S/C14H20O3/c1-14(2,3)11-6-8-12(9-7-11)17-10-4-5-13(15)16/h6-9H,4-5,10H2,1-3H3,(H,15,16)/p-1 |
| InChIKey | SBRAJDSNLRABGN-UHFFFAOYSA-M |
| Boiling point | 388.827°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 142.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Tert-Butyl-Phenoxy)-Butyric Acid |