| Acesys Pharmatech | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (800) 792-0471 / (908) 998-1240 | |||
![]() |
info@acesyspharma.com, | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | (3R,4S)-1-Benzyl-4-(2-fluorophenyl)-3-pyrrolidinecarboxylic acid |
|---|---|
| Synonyms | (4S,3R)-4 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.34 |
| CAS Registry Number | 874990-50-8 |
| SMILES | c1ccc(cc1)CN2C[C@@H]([C@H](C2)C(=O)O)c3ccccc3F |
| InChI | 1S/C18H18FNO2/c19-17-9-5-4-8-14(17)15-11-20(12-16(15)18(21)22)10-13-6-2-1-3-7-13/h1-9,15-16H,10-12H2,(H,21,22)/t15-,16+/m1/s1 |
| InChIKey | DXSKJHNQDSNIJN-CVEARBPZSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.443°C at 760 mmHg (Cal.) |
| Flash point | 215.939°C (Cal.) |
| Refractive index | 1.601 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R,4S)-1-Benzyl-4-(2-fluorophenyl)-3-pyrrolidinecarboxylic acid |