Online Database of Chemicals from Around the World
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (609) 434-0144 | |||
 |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 3,5-Dibromo-N,4-dihydroxybenzenecarboximidamide |
|---|---|
| Synonyms | 3,5-Dibromo-4,N-dihydroxy-benzamidine |
| Molecular Structure |  |
| Molecular Formula | C7H6Br2N2O2 |
| Molecular Weight | 309.94 |
| CAS Registry Number | 875241-38-6 |
| SMILES | Brc1cc(cc(Br)c1O)C(/N)=N\O |
| InChI | 1S/C7H6Br2N2O2/c8-4-1-3(7(10)11-13)2-5(9)6(4)12/h1-2,12-13H,(H2,10,11) |
| InChIKey | OZHZBVZXGAYUFT-UHFFFAOYSA-N |
| Density | 2.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.393°C at 760 mmHg (Cal.) |
| Flash point | 197.765°C (Cal.) |
| Refractive index | 1.712 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dibromo-N,4-dihydroxybenzenecarboximidamide |