| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() | www.rdscientific.com | |||
![]() | +1 (226) 600-0236 | |||
![]() | sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 1-Benzyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.35 |
| CAS Registry Number | 875779-49-0 |
| SMILES | C1=CC=C(C=C1)CN2C=C(C(C(=C2)C(=O)O)C3=CC=CC=C3)C(=O)O |
| Solubility | 40.13 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.664, Calc.* |
| Melting point | 315.49 °C |
| Boiling Point | 558.47 °C, 556.4±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 290.3±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319-H335 Details |
| Safety Statements | P261-P305+P351+P351-P302+P352 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylic acid |