Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Phenyl-1,3-cyclopentadiene-1-carboxamide |
|---|---|
| Synonyms | 2-phenylcyclopenta-1,3-dienecarboxamide |
| Molecular Structure |  |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.22 |
| CAS Registry Number | 875826-06-5 |
| SMILES | c1ccc(cc1)C2=C(CC=C2)C(=O)N |
| InChI | 1S/C12H11NO/c13-12(14)11-8-4-7-10(11)9-5-2-1-3-6-9/h1-7H,8H2,(H2,13,14) |
| InChIKey | PKIJBCKNCKVPMI-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.195°C at 760 mmHg (Cal.) |
| Flash point | 198.855°C (Cal.) |
| Refractive index | 1.631 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-1,3-cyclopentadiene-1-carboxamide |