|
CAS#: 876343-81-6 Product: 5-Bromo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine No suppilers available for the product. |
| Name | 5-Bromo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonyms | 1H-Pyrrol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8BrClN2O2S |
| Molecular Weight | 371.64 |
| CAS Registry Number | 876343-81-6 |
| SMILES | c1ccc(cc1)S(=O)(=O)n2ccc3c2ncc(c3Cl)Br |
| InChI | 1S/C13H8BrClN2O2S/c14-11-8-16-13-10(12(11)15)6-7-17(13)20(18,19)9-4-2-1-3-5-9/h1-8H |
| InChIKey | XNWFHHBKLYJQMS-UHFFFAOYSA-N |
| Density | 1.736g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.279°C at 760 mmHg (Cal.) |
| Flash point | 262.408°C (Cal.) |
| Refractive index | 1.71 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine |