Online Database of Chemicals from Around the World
|
CAS#: 87695-77-0 Product: 5-(Ethylsulfanyl)-1-methyl-4-nitro-1H-imidazole No suppilers available for the product. |
| Name | 5-(Ethylsulfanyl)-1-methyl-4-nitro-1H-imidazole |
|---|---|
| Synonyms | 5-(Ethylthio)-1-methyl-4-nitro-1H-imidazole |
| Molecular Structure |  |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 |
| CAS Registry Number | 87695-77-0 |
| SMILES | CCSc1c(ncn1C)[N+](=O)[O-] |
| InChI | 1S/C6H9N3O2S/c1-3-12-6-5(9(10)11)7-4-8(6)2/h4H,3H2,1-2H3 |
| InChIKey | ANRQVBGDMRWUGJ-UHFFFAOYSA-N |
| Density | 1.395g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.409°C at 760 mmHg (Cal.) |
| Flash point | 181.446°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Ethylsulfanyl)-1-methyl-4-nitro-1H-imidazole |