Online Database of Chemicals from Around the World
|
CAS#: 87750-61-6 Product: (2-Chloro-4-fluorophenyl)(4-fluorophenyl)methanone No suppilers available for the product. |
| Name | (2-Chloro-4-fluorophenyl)(4-fluorophenyl)methanone |
|---|---|
| Synonyms | 2-chloro-4,4'-difluorobenzophenone |
| Molecular Structure |  |
| Molecular Formula | C13H7ClF2O |
| Molecular Weight | 252.64 |
| CAS Registry Number | 87750-61-6 |
| EINECS | 289-345-8 |
| SMILES | O=C(c1ccc(F)cc1Cl)c2ccc(F)cc2 |
| InChI | 1S/C13H7ClF2O/c14-12-7-10(16)5-6-11(12)13(17)8-1-3-9(15)4-2-8/h1-7H |
| InChIKey | XQFWXPFVJXIPIH-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.88°C at 760 mmHg (Cal.) |
| Flash point | 158.749°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chloro-4-fluorophenyl)(4-fluorophenyl)methanone |