|
CAS#: 87766-32-3 Product: N-Benzyl-5-oxo-L-prolinamide No suppilers available for the product. |
| Name | N-Benzyl-5-oxo-L-prolinamide |
|---|---|
| Synonyms | 2-Pyrrolidinecarboxamide, 5-oxo-N-(phenylmethyl)-, (S)-; Pyroglutamyl benzylamide; Pyroglutamylbenzylamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 87766-32-3 |
| SMILES | O=C(NCc1ccccc1)[C@H]2NC(=O)CC2 |
| InChI | 1S/C12H14N2O2/c15-11-7-6-10(14-11)12(16)13-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,16)(H,14,15)/t10-/m0/s1 |
| InChIKey | MDCKMKIRZIXFCH-JTQLQIEISA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.975°C at 760 mmHg (Cal.) |
| Flash point | 244.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Benzyl-5-oxo-L-prolinamide |