|
CAS#: 87980-02-7 Product: 6-Methoxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one No suppilers available for the product. |
| Name | 6-Methoxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one |
|---|---|
| Synonyms | 2,2-Dimethyl-4-oxo-6-methoxybenzo-1,3-dioxin; DOMBD |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 87980-02-7 |
| SMILES | O=C2OC(Oc1ccc(OC)cc12)(C)C |
| InChI | 1S/C11H12O4/c1-11(2)14-9-5-4-7(13-3)6-8(9)10(12)15-11/h4-6H,1-3H3 |
| InChIKey | FPXYFNJIMKQVID-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.298°C at 760 mmHg (Cal.) |
| Flash point | 160.876°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one |