Online Database of Chemicals from Around the World
|
CAS#: 87996-57-4 Product: [4-(Trifluoromethoxy)phenyl][2-(trifluoromethyl)phenyl]methanone No suppilers available for the product. |
| Name | [4-(Trifluoromethoxy)phenyl][2-(trifluoromethyl)phenyl]methanone |
|---|---|
| Synonyms | 4-trifluoromethoxy-2'-trifluoromethylbenzophenone |
| Molecular Structure | ![CAS#: 87996-57-4， [4-(Trifluoromethoxy)phenyl][2-(trifluoromethyl)phenyl]methanone](/moreStructures/87996-57-4.gif) |
| Molecular Formula | C15H8F6O2 |
| Molecular Weight | 334.21 |
| CAS Registry Number | 87996-57-4 |
| EINECS | 289-369-9 |
| SMILES | FC(F)(F)Oc1ccc(cc1)C(=O)c2ccccc2C(F)(F)F |
| InChI | 1S/C15H8F6O2/c16-14(17,18)12-4-2-1-3-11(12)13(22)9-5-7-10(8-6-9)23-15(19,20)21/h1-8H |
| InChIKey | OBAIXSBKXHICFO-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.53°C at 760 mmHg (Cal.) |
| Flash point | 158.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(Trifluoromethoxy)phenyl][2-(trifluoromethyl)phenyl]methanone |