Online Database of Chemicals from Around the World
|
CAS#: 87996-58-5 Product: (4-Fluorophenyl){4-[(trifluoromethyl)sulfanyl]phenyl}methanone No suppilers available for the product. |
| Name | (4-Fluorophenyl){4-[(trifluoromethyl)sulfanyl]phenyl}methanone |
|---|---|
| Synonyms | 4'-fluoro-4-trifluoromethylthiobenzophenone |
| Molecular Structure | ![CAS#: 87996-58-5， (4-Fluorophenyl){4-[(trifluoromethyl)sulfanyl]phenyl}methanone](/moreStructures/87996-58-5.gif) |
| Molecular Formula | C14H8F4OS |
| Molecular Weight | 300.27 |
| CAS Registry Number | 87996-58-5 |
| EINECS | 289-370-4 |
| SMILES | FC(F)(F)Sc1ccc(cc1)C(=O)c2ccc(F)cc2 |
| InChI | 1S/C14H8F4OS/c15-11-5-1-9(2-6-11)13(19)10-3-7-12(8-4-10)20-14(16,17)18/h1-8H |
| InChIKey | PMSGNDUMSOWFEK-UHFFFAOYSA-N |
| Density | 1.402g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.388°C at 760 mmHg (Cal.) |
| Flash point | 139.099°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Fluorophenyl){4-[(trifluoromethyl)sulfanyl]phenyl}methanone |