Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Chem Service, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (610) 692-3026 | |||
|
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Name | Guaiene |
|---|---|
| Synonyms | 7-Isopropylidene-1,4-Dimethyl-2,3,4,5,6,8-Hexahydro-1H-Azulene; .Beta.-Guaiene; (1S-Cis)-1,2,3,4,5,6,7,8-Octahydro-7-Isopropylidene-1,4-Dimethylazulene |
| Molecular Structure |  |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 88-84-6 |
| EINECS | 201-860-1 |
| SMILES | CC2C1=C(C(CCC(C1)=C(C)C)C)CC2 |
| InChI | 1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-12H,5-9H2,1-4H3 |
| InChIKey | GIBQERSGRNPMEH-UHFFFAOYSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 118°C (Expl.) |
| 282.176°C at 760 mmHg (Cal.) | |
| Flash point | 111.707°C (Cal.) |
| Refractive index | 1.503-1.509 (Expl.) |
| Market Analysis Reports |
| List of Reports Available for Guaiene |