Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | trans-4-Ethynylcyclohexanecarbonitrile |
|---|---|
| Synonyms | (1r,4r)-4-ethynylcyclohexanecarbonitrile |
| Molecular Structure |  |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 |
| CAS Registry Number | 88075-29-0 |
| SMILES | C#C[C@H]1CC[C@@H](CC1)C#N |
| InChI | 1S/C9H11N/c1-2-8-3-5-9(7-10)6-4-8/h1,8-9H,3-6H2/t8-,9- |
| InChIKey | JBWTTWXQGVTJRL-KYZUINATSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.5±29.0°C at 760 mmHg (Cal.) |
| Flash point | 90.6±16.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-4-Ethynylcyclohexanecarbonitrile |