Online Database of Chemicals from Around the World
|
CAS#: 88088-23-7 Product: 2-(Methylsulfonyl)-5-phenyl-1,3,4-thiadiazole No suppilers available for the product. |
| Name | 2-(Methylsulfonyl)-5-phenyl-1,3,4-thiadiazole |
|---|---|
| Synonyms | NSC152750; NSC227418 |
| Molecular Structure |  |
| Molecular Formula | C9H8N2O2S2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 88088-23-7 |
| SMILES | O=S(=O)(c1nnc(s1)c2ccccc2)C |
| InChI | 1S/C9H8N2O2S2/c1-15(12,13)9-11-10-8(14-9)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | AFKSITGTMMVRQX-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.396°C at 760 mmHg (Cal.) |
| Flash point | 209.258°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Methylsulfonyl)-5-phenyl-1,3,4-thiadiazole |