| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 2-[5-Hydroxy-2-(3-hydroxypropyl)cyclohexyl]-5-(2-methyl-2-octanyl)phenol |
|---|---|
| Synonyms | [83002-04-4]; 2-[(1r,2r |
| Molecular Structure | ![]() |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.57 |
| CAS Registry Number | 88097-86-3 |
| SMILES | OC2CC(c1ccc(cc1O)C(C)(C)CCCCCC)C(CCCO)CC2 |
| InChI | 1S/C24H40O3/c1-4-5-6-7-14-24(2,3)19-11-13-21(23(27)16-19)22-17-20(26)12-10-18(22)9-8-15-25/h11,13,16,18,20,22,25-27H,4-10,12,14-15,17H2,1-3H3 |
| InChIKey | YNZFFALZMRAPHQ-UHFFFAOYSA-N |
| Density | 1.026g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.446°C at 760 mmHg (Cal.) |
| Flash point | 209.207°C (Cal.) |
| solubility | Soluble to 100 mM in ethanol and to 100 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for 2-[5-Hydroxy-2-(3-hydroxypropyl)cyclohexyl]-5-(2-methyl-2-octanyl)phenol |