Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 3-(3,4-Dihydroxyphenyl)-1-(4-hydroxyphenyl)-2-propen-1-one |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25 |
| CAS Registry Number | 88191-22-4 |
| SMILES | c1cc(ccc1C(=O)C=Cc2ccc(c(c2)O)O)O |
| InChI | 1S/C15H12O4/c16-12-5-3-11(4-6-12)13(17)7-1-10-2-8-14(18)15(19)9-10/h1-9,16,18-19H |
| InChIKey | UPERCWWUZZKHCL-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.359°C at 760 mmHg (Cal.) |
| Flash point | 286.209°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,4-Dihydroxyphenyl)-1-(4-hydroxyphenyl)-2-propen-1-one |