|
CAS#: 88228-58-4 Product: Ruthenocenoyl-glycine No suppilers available for the product. |
| Name | Ruthenocenoyl-glycine |
|---|---|
| Synonyms | Ruppuran; Ruthenocene-103Ru, (((carboxymethyl)amino)carbonyl)-; Ruthenocenoyl-glycine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14NO3103Ru |
| Molecular Weight | 335.16 |
| CAS Registry Number | 88228-58-4 |
| SMILES | C1C=CC=C1.C1=CC(=C(NCC(=O)O)[O-])C=C1.[Ru+2] |
| InChI | 1S/C8H9NO3.C5H6.Ru/c10-7(11)5-9-8(12)6-3-1-2-4-6;1-2-4-5-3-1;/h1-4,9,12H,5H2,(H,10,11);1-4H,5H2;/q;;+2/p-1/i;;1+2 |
| InChIKey | ZLWUBKZNSGLCLP-NGAFWABFSA-M |
| Boiling point | 469.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 237.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ruthenocenoyl-glycine |