Online Database of Chemicals from Around the World
|
CAS#: 882767-85-3 Product: 4-Chloro-6-(3,4-dihydro-1(2H)-quinolinyl)-5-pyrimidinamine No suppilers available for the product. |
| Name | 4-Chloro-6-(3,4-dihydro-1(2H)-quinolinyl)-5-pyrimidinamine |
|---|---|
| Synonyms | 4-Chloro-6-(3,4-dihydro-1(2H)-quinolinyl)-5-pyrimidinamine |
| Molecular Formula | C13H13ClN4 |
| Molecular Weight | 260.72 |
| CAS Registry Number | 882767-85-3 |
| SMILES | Nc1c(Cl)ncnc1N3CCCc2ccccc23 |
| InChI | 1S/C13H13ClN4/c14-12-11(15)13(17-8-16-12)18-7-3-5-9-4-1-2-6-10(9)18/h1-2,4,6,8H,3,5,7,15H2 |
| InChIKey | WGDAFVOCFAAQGO-UHFFFAOYSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.096°C at 760 mmHg (Cal.) |
| Flash point | 229.639°C (Cal.) |
| Refractive index | 1.67 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-6-(3,4-dihydro-1(2H)-quinolinyl)-5-pyrimidinamine |