|
CAS#: 882847-21-4 Product: 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-phenyl-4-piperidinecarboxylic acid No suppilers available for the product. |
| Name | 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-phenyl-4-piperidinecarboxylic acid |
|---|---|
| Synonyms | Fmoc-4-cyclohexyl-piperidine-4-carboxylic acid; Fmoc-4-phenyl-isonipecotic acid; Fmoc-4-phenylpiperidine-4-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.49 |
| CAS Registry Number | 882847-21-4 |
| SMILES | O=C(OCC3c1ccccc1c2ccccc23)N5CCC(C(=O)O)(c4ccccc4)CC5 |
| InChI | 1S/C27H25NO4/c29-25(30)27(19-8-2-1-3-9-19)14-16-28(17-15-27)26(31)32-18-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h1-13,24H,14-18H2,(H,29,30) |
| InChIKey | JWEBOBGECOQGTL-UHFFFAOYSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 633.787°C at 760 mmHg (Cal.) |
| Flash point | 337.102°C (Cal.) |
| Refractive index | 1.636 (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-phenyl-4-piperidinecarboxylic acid |