|
CAS#: 883241-16-5 Product: 6-Methyl-2-[4-(trifluoromethyl)phenyl]nicotinic acid No suppilers available for the product. |
| Name | 6-Methyl-2-[4-(trifluoromethyl)phenyl]nicotinic acid |
|---|---|
| Synonyms | 2-[(4-Trifluoromethyl)phenyl]-6-methylnicotinic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight | 281.23 |
| CAS Registry Number | 883241-16-5 |
| SMILES | Cc1ccc(c(n1)c2ccc(cc2)C(F)(F)F)C(=O)O |
| InChI | 1S/C14H10F3NO2/c1-8-2-7-11(13(19)20)12(18-8)9-3-5-10(6-4-9)14(15,16)17/h2-7H,1H3,(H,19,20) |
| InChIKey | YUGUBPKDGLBTIX-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.444°C at 760 mmHg (Cal.) |
| Flash point | 165.138°C (Cal.) |
| Refractive index | 1.537 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-2-[4-(trifluoromethyl)phenyl]nicotinic acid |