Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-(2-Nitrophenyl)sulfuric diamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C6H7N3O4S |
| Molecular Weight | 217.20 |
| CAS Registry Number | 88394-29-0 |
| SMILES | O=S(N)(=O)Nc1ccccc1[N+]([O-])=O |
| InChI | 1S/C6H7N3O4S/c7-14(12,13)8-5-3-1-2-4-6(5)9(10)11/h1-4,8H,(H2,7,12,13) |
| InChIKey | AZQLBUSBTVCGLW-UHFFFAOYSA-N |
| Density | 1.685g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.884°C at 760 mmHg (Cal.) |
| Flash point | 206.529°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Nitrophenyl)sulfuric diamide |