Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Rieke Metals, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (402) 434-2775 | |||
|
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | 1-(3,5-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone |
|---|---|
| Synonyms | 3',5'-dimethoxy-3-(1,3-dioxan-2-yl)propiophenone; 3',5'-Dimethoxy-3-(1,3-Dioxan-2-Yl)-Propiophenone; MFCD02261846 |
| Molecular Structure |  |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 |
| CAS Registry Number | 884504-44-3 |
| SMILES | COc1cc(cc(OC)c1)C(=O)CCC2OCCCO2 |
| InChI | 1S/C15H20O5/c1-17-12-8-11(9-13(10-12)18-2)14(16)4-5-15-19-6-3-7-20-15/h8-10,15H,3-7H2,1-2H3 |
| InChIKey | FZYFNITYJPUKDX-UHFFFAOYSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.434°C at 760 mmHg (Cal.) |
| Flash point | 180.798°C (Cal.) |
| Refractive index | 1.503 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(3,5-Dimethoxyphenyl)-3-(1,3-dioxan-2-yl)-1-propanone |