|
CAS#: 885230-03-5 Product: 6-(5-Amino-2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine No suppilers available for the product. |
| Name | 6-(5-Amino-2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| Synonyms | 1,2,4-Triazine-3,5-diamine, 6-(5-amino-2,3-dichlorophenyl)-; 6-(5-Amino-2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine; 6-(5-Amino-2,3-dichlorophényl)-1,2,4-triazine-3,5-diamine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8Cl2N6 |
| Molecular Weight | 271.11 |
| CAS Registry Number | 885230-03-5 |
| SMILES | c1c(cc(c(c1c2c(nc(nn2)N)N)Cl)Cl)N |
| InChI | 1S/C9H8Cl2N6/c10-5-2-3(12)1-4(6(5)11)7-8(13)15-9(14)17-16-7/h1-2H,12H2,(H4,13,14,15,17) |
| InChIKey | KSPOPUNATHRTBI-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 599.4±60.0°C at 760 mmHg (Cal.) |
| Flash point | 316.3±32.9°C (Cal.) |
| Refractive index | 1.755 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(5-Amino-2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |